AA08004
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $45.00 | $31.00 | - + | |
5mg | 98% | in stock | $100.00 | $70.00 | - + | |
10mg | 98% | in stock | $160.00 | $112.00 | - + | |
25mg | 98% | in stock | $283.00 | $198.00 | - + | |
50mg | 98% | in stock | $510.00 | $357.00 | - + | |
100mg | 98% | in stock | $635.00 | $444.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA08004 |
Chemical Name: | SGI-1027 |
CAS Number: | 1020149-73-8 |
Molecular Formula: | C27H23N7O |
Molecular Weight: | 461.5178 |
MDL Number: | MFCD27937047 |
SMILES: | Cc1cc(Nc2ccc(cc2)NC(=O)c2ccc(cc2)Nc2ccnc3c2cccc3)nc(n1)N |
Complexity: | 676 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 6 |
XLogP3: | 4.8 |
The compound N-[4-[(2-amino-6-methyl-4-pyrimidinyl)amino]phenyl]-4-(4-quinolinylamino)benzamide, also known as $name$, is commonly used in chemical synthesis as a versatile building block. This molecule plays a crucial role in forming complex structures and functional groups in the field of organic chemistry. Its unique structure allows for selective reactions and precise control over the formation of new compounds. As a key intermediate in synthetic pathways, $name$ is utilized for the synthesis of various pharmaceuticals, agrochemicals, and materials with specific properties. Its strategic placement in a synthetic scheme enables the efficient production of target molecules with desired characteristics, making it an essential component in modern chemical synthesis strategies.
The Journal of biological chemistry 20150306
Journal of medicinal chemistry 20140213
The Journal of biological chemistry 20130816