AA07998
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $201.00 | $141.00 | - + | |
250mg | 95% | in stock | $362.00 | $254.00 | - + | |
1g | 95% | in stock | $712.00 | $498.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA07998 |
Chemical Name: | 3-(Cyclopropylsulfonyl)phenylboronic acid |
CAS Number: | 1020204-12-9 |
Molecular Formula: | C9H11BO4S |
Molecular Weight: | 226.0572 |
MDL Number: | MFCD11617318 |
SMILES: | OB(c1cccc(c1)S(=O)(=O)C1CC1)O |
Complexity: | 318 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
(3-(Cyclopropylsulfonyl)phenyl)boronic acid is a valuable reagent in chemical synthesis due to its versatile applications in organic chemistry. As a boronic acid derivative, it serves as a key building block in Suzuki-Miyaura cross-coupling reactions, a widely-used method for the formation of carbon-carbon bonds. This compound can participate as a boron source in these reactions, facilitating the coupling of aryl halides or pseudohalides with various organic electrophiles, including other aryl or vinyl substrates.In addition to its role in cross-coupling reactions, (3-(Cyclopropylsulfonyl)phenyl)boronic acid is also utilized in the synthesis of biologically active compounds, agrochemicals, and materials science. Its unique structural features, including the cyclopropylsulfonyl group, contribute to the diversity of molecules that can be accessed through its incorporation into target molecules. The presence of the boronic acid functionality allows for further derivatization through various functional group transformations, expanding the synthetic possibilities for chemists in academia and industry alike.