AE16675
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE16675 |
Chemical Name: | ADENYLYL-(3'-5')-GUANOSINE |
CAS Number: | 102029-53-8 |
Molecular Formula: | C20H25N10O11P |
Molecular Weight: | 612.4467 |
MDL Number: | MFCD00051239 |
SMILES: | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)OP(=O)(O)OCC4C(C(C(O4)N5C=NC6=C5N=C(NC6=O)N)O)O)O)N |
Guanosine, adenylyl-(3′→5′)-, monoammonium salt is a valuable reagent in chemical synthesis, particularly in the realm of nucleic acid research and pharmaceutical development. Its unique structure and properties make it a versatile compound for various applications.In chemical synthesis, Guanosine, adenylyl-(3′→5′)-, monoammonium salt is commonly used for the preparation of modified nucleic acids and oligonucleotides. Its ability to selectively modify specific nucleotide sequences allows for the creation of custom-designed nucleic acid molecules with enhanced stability or biological activity. This makes it an essential tool in the development of antisense oligonucleotides, aptamers, and other nucleic acid-based therapeutics.Furthermore, Guanosine, adenylyl-(3′→5′)-, monoammonium salt can also be utilized in the synthesis of novel nucleoside analogs and enzyme inhibitors for studying biological pathways and drug discovery. Its compatibility with various coupling and deprotection chemistries enables efficient and controlled incorporation of the compound into complex molecular structures.Overall, the application of Guanosine, adenylyl-(3′→5′)-, monoammonium salt in chemical synthesis showcases its significance in advancing research and innovation within the fields of nucleic acid chemistry, molecular biology, and pharmaceutical science.