logo
Home  > N-((1R,2R)-2-(3-((1R,2R)-2-(Dimethylamino)cyclohexyl)thioureido)-1,2-diphenylethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide

AA08196

1020665-73-9 | N-((1R,2R)-2-(3-((1R,2R)-2-(Dimethylamino)cyclohexyl)thioureido)-1,2-diphenylethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide

Packsize Purity Availability Price Discounted Price    Quantity
50mg 95% in stock $77.00 $54.00 -   +
250mg 95% in stock $334.00 $234.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA08196
Chemical Name: N-((1R,2R)-2-(3-((1R,2R)-2-(Dimethylamino)cyclohexyl)thioureido)-1,2-diphenylethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide
CAS Number: 1020665-73-9
Molecular Formula: C31H34F6N4O2S2
Molecular Weight: 672.7477
MDL Number: MFCD27922596
SMILES: S=C(N[C@@H]([C@@H](c1ccccc1)NS(=O)(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F)c1ccccc1)N[C@@H]1CCCC[C@H]1N(C)C

 

Upstream Synthesis Route
  • N-((1R,2R)-2-(3-((1R,2R)-2-(Dimethylamino)cyclohexyl)thioureido)-1,2-diphenylethyl)-3,5-bis(trifluoromethyl)benzenesulfonamide is a versatile compound commonly utilized in chemical synthesis processes. Due to its unique structure and properties, this compound serves as a valuable reagent in organic chemistry reactions, particularly in the synthesis of complex molecules and pharmaceutical intermediates. With its functional groups capable of participating in various types of reactions, this compound plays a crucial role in constructing intricate molecular frameworks and facilitating the formation of key chemical bonds. Its application in chemical synthesis enables the creation of novel compounds with diverse functionalities, making it a valuable tool for researchers and chemists working in the field of organic chemistry.
FEATURED PRODUCTS