AE10579
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 2 weeks | $726.00 | $508.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10579 |
Chemical Name: | Hydrazine Hydrate-d6 |
CAS Number: | 102096-80-0 |
Molecular Formula: | D6N2O |
Molecular Weight: | 56.0974 |
MDL Number: | MFCD01074336 |
SMILES: | [2H]O[2H].[2H]N(N([2H])[2H])[2H] |
Hydrazine Hydrate-d6, a deuterated form of hydrazine hydrate, is a valuable chemical reagent widely utilized in various chemical synthesis applications due to its unique isotopic properties. Deuterium, a stable isotope of hydrogen, replaces the protium in hydrazine hydrate to enhance the analytical capabilities of this compound. In chemical synthesis, Hydrazine Hydrate-d6 can be employed as a deuterium source for isotopic labeling studies, allowing researchers to track the movement of deuterium atoms in molecules during reactions. This is crucial for elucidating reaction mechanisms, studying metabolic pathways, and investigating the behavior of complex organic compounds. Additionally, the deuterium in Hydrazine Hydrate-d6 can act as a sensitive probe for detecting hydrogen bonding interactions in molecules, offering valuable insights into molecular structure and reactivity.Furthermore, Hydrazine Hydrate-d6 can serve as a versatile reducing agent in organic synthesis, facilitating various transformations such as reduction of carbonyl compounds to alcohols, hydrazone cleavage, and reductive amination reactions. Its ability to undergo isotopic exchange reactions also makes it a useful tool for kinetic isotope effect studies, kinetic solvent isotope effect investigations, and mechanistic studies in organic chemistry.Overall, Hydrazine Hydrate-d6 plays a crucial role in advancing research in chemical synthesis by providing a powerful tool for isotopic labeling, mechanistic studies, and organic transformations. Its unique isotopic properties make it an indispensable resource for researchers in the field of chemistry.