logo
Home  > Pseudoprotodioscin

AA08438

102115-79-7 | Pseudoprotodioscin

Packsize Purity Availability Price Discounted Price    Quantity
1mg 98% in stock $21.00 $15.00 -   +
5mg 98% in stock $47.00 $33.00 -   +
10mg 98% in stock $57.00 $40.00 -   +
50mg 98% in stock $186.00 $130.00 -   +
100mg 98% in stock $268.00 $188.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA08438
Chemical Name: Pseudoprotodioscin
CAS Number: 102115-79-7
Molecular Formula: C51H82O21
Molecular Weight: 1031.1842
MDL Number: MFCD04039839
SMILES: OC[C@H]1O[C@@H](OC2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@H]4[C@@H]3C(=C(O4)CC[C@H](CO[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)C)C)C)C2)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O

 

Upstream Synthesis Route 
  • Pseudoprotodioscin is a naturally-occurring steroidal saponin that has gained significant attention in the field of chemical synthesis due to its versatile applications. This compound displays unique reactivity and selectivity, making it a valuable tool in various synthetic pathways. In organic chemistry, Pseudoprotodioscin serves as an important precursor for the synthesis of complex molecules, particularly in the development of novel pharmaceuticals and agrochemicals. Its structural features allow for diverse functional group transformations, enabling chemists to introduce specific modifications with high efficiency. Additionally, Pseudoprotodioscin exhibits promising bioactivity, making it a potential candidate for the design and production of bioactive compounds with therapeutic or industrial significance. In summary, the utilization of Pseudoprotodioscin in chemical synthesis showcases its significance as a versatile building block for the creation of intricate molecular structures with tailored properties and functionalities.
FEATURED PRODUCTS