AA08465
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $38.00 | $27.00 | - + | |
5g | 97% | in stock | $122.00 | $86.00 | - + | |
25g | 97% | in stock | $449.00 | $315.00 | - + | |
100g | 97% | in stock | $1,319.00 | $923.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA08465 |
Chemical Name: | 2'-Deoxy-2'-fluorocytidine |
CAS Number: | 10212-20-1 |
Molecular Formula: | C9H12FN3O4 |
Molecular Weight: | 245.2077 |
MDL Number: | MFCD00057445 |
SMILES: | OC[C@H]1O[C@H]([C@@H]([C@@H]1O)F)n1ccc(nc1=O)N |
Complexity: | 386 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 2 |
XLogP3: | -1.1 |
Antiviral research 20111101
Bioorganic & medicinal chemistry letters 20100801
Rapid communications in mass spectrometry : RCM 20091001
Bioorganic & medicinal chemistry letters 20070501
Antiviral chemistry & chemotherapy 20060101
Journal of medicinal chemistry 20050825
Bioorganic & medicinal chemistry 20050301
Nucleosides, nucleotides & nucleic acids 20050101
Antimicrobial agents and chemotherapy 20040201
Journal of chromatography. B, Analytical technologies in the biomedical and life sciences 20030225
Nucleosides, nucleotides & nucleic acids 20030101
Chemical research in toxicology 20020701
Journal of medicinal chemistry 19790101