AE22205
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5mg | 99% | 1 week | $500.00 | $350.00 | - + | |
10mg | 99% | 1 week | $770.00 | $539.00 | - + | |
25mg | 99% | 1 week | $1,490.00 | $1,043.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE22205 |
Chemical Name: | Nemadectin |
CAS Number: | 102130-84-7 |
Molecular Formula: | C36H52O8 |
Molecular Weight: | 612.7932800000001 |
MDL Number: | MFCD00866562 |
SMILES: | CC(/C=C(\[C@H]1O[C@@]2(C[C@@H]3C[C@H](O2)C/C=C(/C)\C[C@@H](C)C=CC=C2[C@]4([C@H](C(=O)O3)C=C(C)[C@H]([C@H]4OC2)O)O)C[C@@H]([C@@H]1C)O)/C)C |
Nemadectin, a macrocyclic lactone derivative, finds versatile applications in chemical synthesis due to its unique properties. This compound serves as a valuable building block for the development of various pharmaceuticals, agricultural chemicals, and materials in the field of organic chemistry. In chemical synthesis, Nemadectin is commonly utilized as a key intermediate for the generation of novel compounds through strategic functional group interconversions or structural modifications. Leveraging its rich chemistry, Nemadectin facilitates the construction of complex molecular architectures, enabling chemists to access diverse chemical space and design innovative molecules with enhanced biological activities and physicochemical properties. Furthermore, the high selectivity and reactivity of Nemadectin make it an essential tool in the synthesis of biologically active compounds and natural product analogs, showcasing its significance in modern organic synthesis.