logo
Home  > (11bR)-N,N-Bis((S)-1-phenylethyl)-8,9,10,11,12,13,14,15-octahydrodinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine

BA39966

1021439-60-0 | (11bR)-N,N-Bis((S)-1-phenylethyl)-8,9,10,11,12,13,14,15-octahydrodinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $47.00 $33.00 -   +
250mg 97% in stock $89.00 $62.00 -   +
1g 97% in stock $352.00 $247.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: BA39966
Chemical Name: (11bR)-N,N-Bis((S)-1-phenylethyl)-8,9,10,11,12,13,14,15-octahydrodinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine
CAS Number: 1021439-60-0
Molecular Formula: C36H38NO2P
Molecular Weight: 547.6662
MDL Number: MFCD13430248
SMILES: CC(C1=CC=CC=C1)N(C(C)C2=CC=CC=C2)P3OC4=C(C5=C(CCCC5)C=C4)C6=C(O3)C=CC7=C6CCCC7

 

Upstream Synthesis Route 
  • The compound (11bR)-N,N-Bis((S)-1-phenylethyl)-8,9,10,11,12,13,14,15-octahydrodinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine has significant applications in chemical synthesis due to its unique structure and properties. It can serve as a versatile chiral ligand in asymmetric catalysis, particularly in metal-catalyzed reactions. This compound can effectively control the stereochemistry of a reaction and promote the formation of enantiomerically pure products. Additionally, it can be utilized in the preparation of complex organic molecules and pharmaceutical intermediates by enabling efficient and selective bond formations. Overall, (11bR)-N,N-Bis((S)-1-phenylethyl)-8,9,10,11,12,13,14,15-octahydrodinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine plays a crucial role in enhancing the efficiency and selectivity of chemical transformations in synthetic applications.
FEATURED PRODUCTS