AA08691
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 97% | in stock | $59.00 | $41.00 | - + | |
50mg | 97% | in stock | $65.00 | $45.00 | - + | |
100mg | 97% | in stock | $76.00 | $53.00 | - + | |
250mg | 97% | in stock | $146.00 | $103.00 | - + | |
1g | 97% | in stock | $354.00 | $248.00 | - + | |
5g | 97% | in stock | $1,084.00 | $759.00 | - + | |
25g | 97% | in stock | $2,918.00 | $2,043.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA08691 |
Chemical Name: | 5-[1-(2,3-Dimethylphenyl)ethenyl]-1H-imidazole |
CAS Number: | 1021949-47-2 |
Molecular Formula: | C13H14N2 |
Molecular Weight: | 198.2637 |
MDL Number: | MFCD13180466 |
SMILES: | Cc1cccc(c1C)C(=C)c1cnc[nH]1 |
Complexity: | 237 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 3.5 |
5-(1-(2,3-Dimethylphenyl)vinyl)-1H-imidazole is a versatile compound that finds widespread application in chemical synthesis. Primarily, it serves as a key building block in the creation of various organic molecules by participating in numerous synthetic transformations. This compound's unique structure and reactivity make it a valuable tool in the creation of pharmaceuticals, agrochemicals, and materials science. Its presence in a synthetic scheme can lead to the formation of structurally diverse and complex compounds through various reactions like cross-coupling, cycloaddition, and oxidation processes. With its ability to introduce specific functional groups and stereochemistry into target molecules, 5-(1-(2,3-Dimethylphenyl)vinyl)-1H-imidazole significantly enhances the synthetic chemist's toolbox, enabling the efficient and precise construction of intricate molecular architectures.