AE11333
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98+% | in stock | $12.00 | $9.00 | - + | |
2mg | 98+% | in stock | $20.00 | $14.00 | - + | |
5mg | 98+% | in stock | $30.00 | $21.00 | - + | |
10mg | 98+% | in stock | $43.00 | $30.00 | - + | |
25mg | 98%(HPLC) | in stock | $103.00 | $73.00 | - + | |
50mg | 98+% | in stock | $114.00 | $80.00 | - + | |
250mg | 98+% | in stock | $300.00 | $210.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11333 |
Chemical Name: | Sgx-523 |
CAS Number: | 1022150-57-7 |
Molecular Formula: | C18H13N7S |
Molecular Weight: | 359.4077 |
MDL Number: | MFCD16660190 |
SMILES: | Cn1ncc(c1)c1ccc2n(n1)c(nn2)Sc1ccc2c(c1)cccn2 |
Complexity: | 494 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 6 |
Rotatable Bond Count: | 3 |
XLogP3: | 2.4 |
Bioorganic & medicinal chemistry letters 20130801
Nature biotechnology 20111030
Chemistry & biology 20101124
Cancer research 20100901
Drug metabolism and disposition: the biological fate of chemicals 20100801
Anti-cancer agents in medicinal chemistry 20100101
Molecular cancer therapeutics 20091201