logo
Home  > 2-Butoxyquinoline-4-carboxylic acid

AA08834

10222-61-4 | 2-Butoxyquinoline-4-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $14.00 $10.00 -   +
250mg 98% in stock $27.00 $19.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA08834
Chemical Name: 2-Butoxyquinoline-4-carboxylic acid
CAS Number: 10222-61-4
Molecular Formula: C14H15NO3
Molecular Weight: 245.2738
MDL Number: MFCD11527607
SMILES: CCCCOc1nc2ccccc2c(c1)C(=O)O

 

Upstream Synthesis Route 
  • The application of 2-Butoxyquinoline-4-carboxylic acid in chemical synthesis is particularly significant due to its role as a versatile building block in the creation of various pharmaceutical compounds. This compound serves as a valuable intermediate in the development of diverse drug candidates and bioactive molecules. Its unique chemical structure enables it to participate in a range of synthetic transformations, allowing for the efficient production of complex organic compounds. Through strategic manipulation of its functional groups, researchers can tailor the properties of the resulting molecules, influencing factors such as solubility, stability, and biological activity. In addition, the incorporation of 2-Butoxyquinoline-4-carboxylic acid into synthetic pathways can streamline the synthesis process, leading to improved efficiency and overall yield of the desired products.
FEATURED PRODUCTS