AI86386
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 90% | 2 weeks | $284.00 | $199.00 | - + | |
5mg | 90% | 2 weeks | $303.00 | $212.00 | - + | |
10mg | 90% | 2 weeks | $338.00 | $237.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI86386 |
Chemical Name: | ethyl 3-{[4-(2-fluorophenyl)piperazine-1-carbothioyl]amino}propanoate |
CAS Number: | 1022235-03-5 |
Molecular Formula: | C16H22FN3O2S |
Molecular Weight: | 339.4282 |
MDL Number: | MFCD00955137 |
SMILES: | CCOC(=O)CCNC(=S)N1CCN(CC1)c1ccccc1F |
Ethyl 3-({[4-(2-fluorophenyl)piperazino]carbothioyl}amino)propanoate is a versatile compound that finds application in chemical synthesis, particularly in the field of medicinal chemistry and drug discovery. This compound serves as a key intermediate in the synthesis of various bioactive molecules and pharmaceuticals.With its unique structural properties, Ethyl 3-({[4-(2-fluorophenyl)piperazino]carbothioyl}amino)propanoate offers opportunities for the creation of novel chemical entities with potential therapeutic effects. Its presence in synthetic routes allows for the introduction of specific functionalities and structural motifs that are vital for enhancing biological activity and optimizing pharmacokinetic properties of the final compounds.In chemical synthesis, this compound can be utilized as a building block to incorporate the piperazino-carbothioamide moiety into the molecular structure of target compounds. This functional group is known to impart desirable pharmacological properties, making it an essential component in the design of new drug candidates.Furthermore, Ethyl 3-({[4-(2-fluorophenyl)piperazino]carbothioyl}amino)propanoate serves as a valuable tool for research purposes, enabling chemists to explore structure-activity relationships and investigate the impact of molecular modifications on biological interactions. Its incorporation in diverse synthetic strategies underscores its significance in advancing the development of innovative pharmaceutical agents.