AA08989
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $15.00 | $10.00 | - + | |
1g | 97% | in stock | $25.00 | $17.00 | - + | |
5g | 97% | in stock | $65.00 | $45.00 | - + | |
10g | 97% | in stock | $113.00 | $79.00 | - + | |
25g | 97% | in stock | $278.00 | $194.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA08989 |
Chemical Name: | (2R)-2-Amino-3-(4-aminophenyl)propanoic acid hydrate |
CAS Number: | 102281-45-8 |
Molecular Formula: | C9H12N2O2 |
Molecular Weight: | 180.20377999999997 |
MDL Number: | MFCD08276892 |
SMILES: | N[C@@H](C(=O)O)Cc1ccc(cc1)N |
Complexity: | 177 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 3 |
XLogP3: | -2.2 |
The (R)-2-Amino-3-(4-aminophenyl)propanoic acid, also known as $name$, serves as a valuable intermediate in chemical synthesis, particularly in the pharmaceutical industry. Its chiral nature and unique molecular structure make it a versatile building block for the synthesis of various biologically active compounds. When utilized in chemical reactions, (R)-2-Amino-3-(4-aminophenyl)propanoic acid can act as a key component for the creation of complex molecules with specific stereochemical properties. This compound plays a crucial role in the development of new drug candidates, as it enables chemists to access diverse chemical space and explore different molecular arrangements. Additionally, (R)-2-Amino-3-(4-aminophenyl)propanoic acid's compatibility with various reaction conditions further enhances its utility in organic synthesis, making it an essential tool for researchers working in the field of medicinal chemistry.