AA09046
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $15.00 | $10.00 | - + | |
1g | 98% | in stock | $16.00 | $11.00 | - + | |
5g | 98% | in stock | $18.00 | $13.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09046 |
Chemical Name: | 2-Chloro-5-(trifluoromethoxy)phenylboronic acid |
CAS Number: | 1022922-16-2 |
Molecular Formula: | C7H5BClF3O3 |
Molecular Weight: | 240.372 |
MDL Number: | MFCD06656267 |
SMILES: | OB(c1cc(ccc1Cl)OC(F)(F)F)O |
Complexity: | 214 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
(2-Chloro-5-(trifluoromethoxy)phenyl)boronic acid is a versatile chemical compound widely used in chemical synthesis. As a boronic acid derivative, it plays a crucial role in Suzuki-Miyaura cross-coupling reactions, which are powerful tools in organic chemistry for forming carbon-carbon bonds. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and materials due to its ability to participate in coupling reactions with aryl halides and related compounds. Additionally, (2-Chloro-5-(trifluoromethoxy)phenyl)boronic acid is known for its stability and compatibility with a wide range of functional groups, making it a valuable reagent in the creation of complex organic molecules. Whether employed in medicinal chemistry, materials science, or other fields, this compound's utility in chemical synthesis is indispensable for the development of innovative compounds and materials.