AA09380
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $6.00 | $4.00 | - + | |
250mg | 98% | in stock | $7.00 | $5.00 | - + | |
5g | 95% | in stock | $35.00 | $25.00 | - + | |
10g | 95% | in stock | $67.00 | $47.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09380 |
Chemical Name: | 5-Methylindole-2-carboxylic acid |
CAS Number: | 10241-97-1 |
Molecular Formula: | C10H9NO2 |
Molecular Weight: | 175.1840 |
MDL Number: | MFCD00047166 |
SMILES: | Cc1ccc2c(c1)cc([nH]2)C(=O)O |
NSC Number: | 88873 |
Complexity: | 217 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.7 |
Bioorganic & medicinal chemistry letters 20100115
Bioorganic & medicinal chemistry letters 20090901
Journal of medicinal chemistry 20040506