AA09407
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $12.00 | $8.00 | - + | |
1g | 98% | in stock | $16.00 | $12.00 | - + | |
5g | 98% | in stock | $79.00 | $56.00 | - + | |
10g | 98% | in stock | $147.00 | $103.00 | - + | |
25g | 98% | in stock | $328.00 | $230.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09407 |
Chemical Name: | 5-Methoxyindole-3-carboxylic acid |
CAS Number: | 10242-01-0 |
Molecular Formula: | C10H9NO3 |
Molecular Weight: | 191.1834 |
MDL Number: | MFCD03265451 |
SMILES: | COc1ccc2c(c1)c(c[nH]2)C(=O)O |
NSC Number: | 88877 |
Complexity: | 231 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 2 |
XLogP3: | 2 |
5-Methoxy-1H-indole-3-carboxylic acid, also known as $name$, serves as a versatile building block in chemical synthesis. With its unique structure and reactivity, this compound is commonly utilized in the preparation of various advanced organic molecules. Its application extends to the realm of pharmaceuticals, where it acts as a key intermediate in the synthesis of biologically active compounds. Additionally, $name$ finds utility in the development of novel materials and specialty chemicals, showcasing its importance in modern chemical research. Through strategic transformations and functionalization, this compound enables chemists to access a diverse array of complex chemical structures, making it a valuable tool in synthetic chemistry.
Drug metabolism and disposition: the biological fate of chemicals 20011001