AA09428
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 97% | in stock | $18.00 | $13.00 | - + | |
5g | 97% | in stock | $88.00 | $62.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09428 |
Chemical Name: | 5-Chlorobenzofuran-2-carboxylic acid |
CAS Number: | 10242-10-1 |
Molecular Formula: | C9H5ClO3 |
Molecular Weight: | 196.5872 |
MDL Number: | MFCD00060512 |
SMILES: | Clc1ccc2c(c1)cc(o2)C(=O)O |
Complexity: | 219 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3 |
Bioorganic & medicinal chemistry letters 20101101
Journal of medicinal chemistry 20040506