AA09426
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $22.00 | $15.00 | - + | |
1g | 95% | in stock | $37.00 | $26.00 | - + | |
5g | 95% | in stock | $130.00 | $91.00 | - + | |
10g | 95% | in stock | $238.00 | $166.00 | - + | |
25g | 95% | in stock | $463.00 | $324.00 | - + | |
100g | 95% | in stock | $1,086.00 | $760.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09426 |
Chemical Name: | 5-Nitrobenzofuran-2-carboxylic acid |
CAS Number: | 10242-12-3 |
Molecular Formula: | C9H5NO5 |
Molecular Weight: | 207.1397 |
MDL Number: | MFCD00060513 |
SMILES: | OC(=O)c1cc2c(o1)ccc(c2)[N+](=O)[O-] |
Complexity: | 287 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.2 |
5-Nitrobenzofuran-2-carboxylic acid, also known as NBFC acid, serves as a versatile building block in chemical synthesis. Its unique structure and properties make it a valuable tool in creating a wide range of organic molecules. One of the primary applications of 5-Nitrobenzofuran-2-carboxylic acid is as a key intermediate in the synthesis of various pharmaceutical compounds. By utilizing this compound, chemists can introduce specific functional groups and structural motifs into drug candidates, allowing for fine-tuning of their properties and enhancing their biological activity. Additionally, 5-Nitrobenzofuran-2-carboxylic acid can be employed in the preparation of advanced materials, such as dyes, agrochemicals, and polymers. Its ability to participate in diverse chemical reactions enables the efficient construction of complex molecular architectures, paving the way for the development of innovative products across different industries. As a crucial component in organic synthesis, 5-Nitrobenzofuran-2-carboxylic acid plays a pivotal role in the creation of novel compounds with tailored functionalities, making it an indispensable tool for chemists seeking to push the boundaries of molecular design and discovery.