logo
Home  > 6-Methyl-2-oxo-2H-chromene-3-carboxylic acid

AA09425

10242-13-4 | 6-Methyl-2-oxo-2H-chromene-3-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% 2 weeks $94.00 $66.00 -   +
1g 95% 2 weeks $239.00 $167.00 -   +
5g 95% 2 weeks $816.00 $572.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA09425
Chemical Name: 6-Methyl-2-oxo-2H-chromene-3-carboxylic acid
CAS Number: 10242-13-4
Molecular Formula: C11H8O4
Molecular Weight: 204.1788
MDL Number: MFCD01662452
SMILES: Cc1ccc2c(c1)cc(c(=O)o2)C(=O)O

 

Upstream Synthesis Route
  • 6-Methyl-2-oxo-2H-chromene-3-carboxylic acid, also known as $name$, is a versatile compound that plays a crucial role in chemical synthesis processes. This compound is widely utilized as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals.In chemical synthesis, $name$ serves as a valuable building block for the production of a wide range of bioactive compounds. Its unique structure and functional groups make it a valuable starting material for the creation of diverse molecules with important biological activities. By incorporating $name$ into synthetic pathways, chemists can access a variety of structurally complex compounds that exhibit potential therapeutic, agricultural, or industrial applications.Moreover, the distinct reactivity of the chromene ring and the carboxylic acid moiety in $name$ enables chemists to introduce specific functionalities and stereochemistry into the final target molecules. This allows for precise control over the synthesis process and the ability to tailor the properties of the end products according to desired specifications.Overall, the application of 6-Methyl-2-oxo-2H-chromene-3-carboxylic acid in chemical synthesis provides chemists with a powerful tool for the efficient construction of valuable compounds with diverse applications. Its significance in the field of organic chemistry highlights its importance as a key component in the development of novel molecules with potential industrial and pharmaceutical relevance.
FEATURED PRODUCTS