logo
Home  > Chemistry  > Organic Building Blocks  > Esters  > Ethyl 1-Methyl-3-phenylpyrazole-5-carboxylate

AA09641

10250-63-2 | Ethyl 1-Methyl-3-phenylpyrazole-5-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $25.00 $17.00 -   +
250mg 95% in stock $52.00 $36.00 -   +
1g 95% in stock $58.00 $41.00 -   +
5g 95% in stock $192.00 $135.00 -   +
25g 95% in stock $642.00 $449.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA09641
Chemical Name: Ethyl 1-Methyl-3-phenylpyrazole-5-carboxylate
CAS Number: 10250-63-2
Molecular Formula: C13H14N2O2
Molecular Weight: 230.26246000000003
MDL Number: MFCD03933288
SMILES: CCOC(=O)c1cc(nn1C)c1ccccc1

 

Computed Properties
Complexity: 264  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 17  
Hydrogen Bond Acceptor Count: 3  
Rotatable Bond Count: 4  
XLogP3: 2.4  

 

 

Upstream Synthesis Route
  • Ethyl 1-methyl-3-phenyl-1H-pyrazole-5-carboxylate is a versatile compound widely utilized in chemical synthesis, particularly in the field of medicinal chemistry. This compound serves as a key building block in the preparation of various pharmaceutical intermediates and bioactive molecules.In synthetic chemistry, Ethyl 1-methyl-3-phenyl-1H-pyrazole-5-carboxylate can be employed in the construction of heterocyclic structures through derivatization and functionalization reactions. Its unique molecular structure offers opportunities for modification and diversification, making it a valuable tool for creating novel compounds with potentially beneficial properties.Furthermore, due to its presence in the core structure of many biologically active molecules, Ethyl 1-methyl-3-phenyl-1H-pyrazole-5-carboxylate plays a crucial role in the development of new drug candidates and therapeutic agents. Its incorporation into the synthesis of pharmaceuticals can lead to the discovery of innovative treatments for various diseases and conditions.Overall, Ethyl 1-methyl-3-phenyl-1H-pyrazole-5-carboxylate is a key component in chemical synthesis, enabling the creation of diverse molecules with potential applications in medicinal chemistry and pharmaceutical research.
FEATURED PRODUCTS