AA09726
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $29.00 | $20.00 | - + | |
250mg | 95% | in stock | $43.00 | $30.00 | - + | |
1g | 95% | in stock | $132.00 | $92.00 | - + | |
2.5g | 95% | in stock | $322.00 | $225.00 | - + | |
5g | 95% | in stock | $460.00 | $322.00 | - + | |
10g | 95% | in stock | $828.00 | $580.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09726 |
Chemical Name: | 4-[(Methylamino)sulfonyl]benzoic acid |
CAS Number: | 10252-63-8 |
Molecular Formula: | C8H9NO4S |
Molecular Weight: | 215.2264 |
MDL Number: | MFCD05804382 |
SMILES: | CNS(=O)(=O)c1ccc(cc1)C(=O)O |
Complexity: | 298 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.8 |
4-(N-Methylsulfamoyl)benzoic acid is a versatile compound that finds wide application in chemical synthesis. As a sulfonamide derivative of benzoic acid, this compound serves as a crucial building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty organic compounds. Its unique structure and functional groups make it a valuable intermediate in the creation of complex molecules with diverse biological activities. In chemical synthesis, 4-(N-Methylsulfamoyl)benzoic acid is commonly used as a key starting material for the development of novel drugs, such as anti-inflammatory agents, antimicrobials, and antivirals. Additionally, its presence in the synthesis of herbicides and insecticides highlights its significance in the agricultural industry. With its ability to participate in a range of reactions, including amide formation, nucleophilic substitutions, and aromatic ring modifications, this compound plays a vital role in the creation of potent bioactive compounds with targeted functions.
Journal of medicinal chemistry 19971205