BE12850
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BE12850 |
Chemical Name: | Urea, N-[3-[(3S,4R,5R)-3-butyl-7-(dimethylamino)-3-ethyl-2,3,4,5-tetrahydro-4-hydroxy-1,1-dioxido-1-benzothiepin-5-yl]phenyl]-N′-[3-O-(phenylmethyl)-6-O-sulfo-β-D-glucopyranosyl]- |
CAS Number: | 1025216-57-2 |
Molecular Formula: | C38H51N3O12S2 |
Molecular Weight: | 805.9544 |
SMILES: | CCCC[C@]1(CC)CS(=O)(=O)c2c([C@H]([C@H]1O)c1cccc(c1)NC(=O)N[C@@H]1O[C@H](COS(=O)(=O)O)[C@H]([C@@H]([C@H]1O)OCc1ccccc1)O)cc(cc2)N(C)C |
The compound N-[3-[(3S,4R,5R)-3-Butyl-7-(dimethylamino)-3-ethyl-2,3,4,5-tetrahydro-4-hydroxy-1,1-dioxido-1-benzothiepin-5-yl]phenyl]-N′-[3-O-(phenylmethyl)-6-O-sulfo-β-D-glucopyranosyl]urea has a significant application in chemical synthesis. It can be used as a versatile building block in organic chemistry reactions, particularly in the formation of complex molecules. Due to its unique structural features, this compound can participate in various bond-forming processes, such as amide formation, glycosylation reactions, and sulfonation reactions. Its functional groups offer multiple points for further derivatization, enabling the creation of diverse chemical structures for drug development, materials science, and other research areas.