logo
Home  > Arg-Phe-Asp-Ser

AA09821

102567-19-1 | Arg-Phe-Asp-Ser

Packsize Purity Availability Price Discounted Price    Quantity
100mg 99% 1 week $53.00 $37.00 -   +
250mg 99% 1 week $122.00 $86.00 -   +
1g 99% 1 week $365.00 $255.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AA09821
Chemical Name: Arg-Phe-Asp-Ser
CAS Number: 102567-19-1
Molecular Formula: C22H33N7O8
Molecular Weight: 523.53952
MDL Number: MFCD00076457
SMILES: OC[C@@H](C(=O)O)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)N)Cc1ccccc1)CC(=O)O

 

Upstream Synthesis Route 
  • The tetrapeptide Arg-Phe-Asp-Ser, often referred to as RFDS, is a versatile molecule frequently employed in chemical synthesis for its unique properties and diverse applications. In the realm of organic chemistry, RFDS plays a crucial role as a building block in the construction of peptide sequences and other complex molecular structures. Due to its specific amino acid arrangement, RFDS is adept at forming stable bonds with complementary molecules, making it an essential component in creating peptide libraries, studying protein-protein interactions, and designing novel pharmaceutical compounds. Additionally, RFDS can be utilized in the development of drug delivery systems, molecular probes, and bioconjugates, showcasing its significance in the advancement of various fields within chemical research and development.
FEATURED PRODUCTS