AA09885
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $19.00 | $14.00 | - + | |
5mg | 98% | in stock | $54.00 | $38.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09885 |
Chemical Name: | BMS-777607 |
CAS Number: | 1025720-94-8 |
Molecular Formula: | C25H19ClF2N4O4 |
Molecular Weight: | 512.8926 |
MDL Number: | MFCD16495773 |
SMILES: | CCOc1ccn(c(=O)c1C(=O)Nc1ccc(c(c1)F)Oc1ccnc(c1Cl)N)c1ccc(cc1)F |
Complexity: | 867 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 36 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 7 |
XLogP3: | 4 |
Molecular oncology 20140501
Bioorganic & medicinal chemistry letters 20130801
Clinical & experimental metastasis 20120301
BMC cancer 20120101
ACS medicinal chemistry letters 20111208
Molecular cancer therapeutics 20100601
Journal of medicinal chemistry 20090312