AA09911
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 96% | in stock | $105.00 | $74.00 | - + | |
1g | 96% | in stock | $209.00 | $147.00 | - + | |
5g | 96% | in stock | $564.00 | $395.00 | - + | |
10g | 96% | in stock | $1,022.00 | $716.00 | - + | |
25g | 96% | in stock | $1,878.00 | $1,315.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA09911 |
Chemical Name: | 2-Methoxy-5-(tributylstannyl)thiazole |
CAS Number: | 1025744-42-6 |
Molecular Formula: | C16H31NOSSn |
Molecular Weight: | 404.1894 |
MDL Number: | MFCD09025806 |
SMILES: | CCCC[Sn](c1cnc(s1)OC)(CCCC)CCCC |
Complexity: | 231 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 11 |
2-Methoxy-5-(tributylstannyl)thiazole is a versatile compound that finds application in various chemical synthesis processes. As a thiazole derivative, it serves as a valuable building block in the creation of complex organic molecules. Thanks to the presence of the methoxy and tributylstannyl groups, this compound can participate in a range of transformations, including cross-coupling reactions, Grignard reactions, and palladium-catalyzed coupling reactions. Its unique structure imparts both reactivity and selectivity, making it a valuable tool for synthetic chemists looking to access diverse chemical space. In pharmaceutical research, this compound can be used to introduce specific functionalities or structural motifs into drug candidates, contributing to the development of new and improved therapeutic agents. In summary, 2-Methoxy-5-(tributylstannyl)thiazole plays a crucial role in enabling the efficient construction of complex molecules for various applications, highlighting its significance in modern organic synthesis strategies.