logo
Home  > Chemistry  > Organic Building Blocks  > Alcohols  > CAPSO sodium salt

AA10014

102601-34-3 | CAPSO sodium salt

Packsize Purity Availability Price Discounted Price    Quantity
5g 98% in stock $25.00 $17.00 -   +
25g 98% in stock $33.00 $23.00 -   +
100g 98% in stock $75.00 $52.00 -   +
250g 98% in stock $126.00 $88.00 -   +
500g 98% in stock $249.00 $175.00 -   +
1kg 98% in stock $369.00 $258.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA10014
Chemical Name: CAPSO sodium salt
CAS Number: 102601-34-3
Molecular Formula: C9H18NNaO4S
Molecular Weight: 259.2983
MDL Number: MFCD00070063
SMILES: OC(CS(=O)(=O)[O-])CNC1CCCCC1.[Na+]

 

Computed Properties
Complexity: 272  
Covalently-Bonded Unit Count: 2  
Heavy Atom Count: 16  
Hydrogen Bond Acceptor Count: 5  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 5  
Undefined Atom Stereocenter Count: 1  

 

 

Upstream Synthesis Route
  • Sodium 3-(cyclohexylamino)-2-hydroxypropane-1-sulfonate, commonly known as $name$, is a versatile compound known for its valuable role in chemical synthesis. This compound is widely utilized as a reagent in organic chemistry reactions, particularly in the synthesis of various pharmaceuticals and complex organic molecules.$name$ serves as an important intermediate in the creation of bioactive compounds due to its unique chemical structure and properties. Its sulfonate group provides excellent solubility in aqueous solutions, making it an ideal starting material for reactions that require water as a solvent. Additionally, the presence of the hydroxypropane moiety allows for selective functional group transformations, enabling chemists to tailor the molecule for specific synthetic pathways.In chemical synthesis, $name$ is often employed as a protecting group for sensitive functional groups, shielding them from undesired reactions during the synthesis process. Its cyclohexylamino moiety can also act as a directing group, facilitating regioselective reactions and leading to the formation of desired products with high efficiency.Overall, the application of Sodium 3-(cyclohexylamino)-2-hydroxypropane-1-sulfonate in chemical synthesis showcases its importance as a versatile building block in the creation of complex organic molecules with diverse applications in pharmaceuticals, materials science, and beyond.
FEATURED PRODUCTS