AA10118
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $15.00 | $10.00 | - + | |
25g | 98% | in stock | $41.00 | $29.00 | - + | |
100g | 98% | in stock | $105.00 | $74.00 | - + | |
500g | 98% | in stock | $386.00 | $270.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA10118 |
Chemical Name: | 5-Difluoromethoxy-2-[(3,4-dimethoxy-2-pyridinyl)methyl]thio-1H-benzimidazole |
CAS Number: | 102625-64-9 |
Molecular Formula: | C16H15F2N3O3S |
Molecular Weight: | 367.3704 |
MDL Number: | MFCD07368273 |
SMILES: | COc1c(nccc1OC)CSc1nc2c([nH]1)cc(cc2)OC(F)F |
Complexity: | 424 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 7 |
XLogP3: | 3.7 |
5-(Difluoromethoxy)-2-[[(3,4-dimethoxy-2-pyridinyl)methyl]thio]-1H-benzimidazole is a versatile compound frequently utilized in chemical synthesis for its unique properties. This compound serves as a valuable building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its difluoromethoxy group imparts enhanced reactivity and stability, making it a preferred choice in organic synthesis processes. The presence of the benzimidazole scaffold and thioether linkage further expands its utility by enabling the formation of diverse molecular architectures with potent biological activities. This compound plays a pivotal role in the development of novel drug candidates and functional materials through strategic synthetic transformations, highlighting its significance in modern organic chemistry applications.
Journal of pharmaceutical and biomedical analysis 20071018