logo
Home  > Chemistry  > Organic Building Blocks  > Trifluoromethyls  > Methyl 2-bromo-5-(trifluoromethyl)benzoate

AA10155

1026355-57-6 | Methyl 2-bromo-5-(trifluoromethyl)benzoate

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $9.00 $7.00 -   +
250mg 98% in stock $15.00 $11.00 -   +
1g 98% in stock $50.00 $35.00 -   +
5g 98% in stock $178.00 $124.00 -   +
25g 98% in stock $713.00 $499.00 -   +
100g 98% in stock $2,313.00 $1,619.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AA10155
Chemical Name: Methyl 2-bromo-5-(trifluoromethyl)benzoate
CAS Number: 1026355-57-6
Molecular Formula: C9H6BrF3O2
Molecular Weight: 283.0419
MDL Number: MFCD09999461
SMILES: COC(=O)c1cc(ccc1Br)C(F)(F)F

 

Computed Properties
Complexity: 242  
Covalently-Bonded Unit Count: 1  
Heavy Atom Count: 15  
Hydrogen Bond Acceptor Count: 5  
Rotatable Bond Count: 2  
XLogP3: 3.4  

 

 

Upstream Synthesis Route
  • Methyl 2-bromo-5-(trifluoromethyl)benzoate is a versatile compound widely used in chemical synthesis. This specific molecule serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and materials. Its unique structure containing both bromine and trifluoromethyl groups enables it to participate in a range of important reactions such as nucleophilic substitution, cross-coupling, and lithiation, allowing for the efficient construction of complex organic molecules. Furthermore, the presence of the trifluoromethyl group enhances the compound's lipophilicity and metabolic stability, making it particularly valuable in the design of bioactive compounds. In summary, Methyl 2-bromo-5-(trifluoromethyl)benzoate plays a crucial role in modern synthetic chemistry by facilitating the synthesis of diverse functional molecules with applications across various sectors.
FEATURED PRODUCTS