BK12900
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $90.00 | $63.00 | - + | |
250mg | 95% | in stock | $150.00 | $105.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BK12900 |
Chemical Name: | 4-(Methylsulfonyl)Picolinic Acid |
CAS Number: | 1026676-25-4 |
Molecular Formula: | C7H7NO4S |
Molecular Weight: | 201.1998 |
MDL Number: | MFCD18261198 |
SMILES: | OC(=O)c1nccc(c1)S(=O)(=O)C |
4-(Methylsulfonyl)picolinic acid is a versatile compound commonly used in chemical synthesis as a building block for the creation of various organic molecules. Due to its unique structure, this compound serves as an important precursor in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. With its sulfone group and picolinic acid backbone, 4-(Methylsulfonyl)picolinic acid offers numerous synthetic possibilities, allowing chemists to efficiently introduce functional groups and modify molecular structures. This compound is particularly valuable in medicinal chemistry for creating drug candidates with enhanced pharmacological properties. In organic synthesis, 4-(Methylsulfonyl)picolinic acid plays a crucial role in the preparation of complex molecules with specific biological activities, making it a valuable tool for researchers and synthetic chemists.