AA10301
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $17.00 | $12.00 | - + | |
5g | 98% | in stock | $45.00 | $32.00 | - + | |
10g | 98% | in stock | $90.00 | $63.00 | - + | |
25g | 98% | in stock | $168.00 | $118.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA10301 |
Chemical Name: | Methyl 3-nitrophenylacetate |
CAS Number: | 10268-12-9 |
Molecular Formula: | C9H9NO4 |
Molecular Weight: | 195.1721 |
MDL Number: | MFCD08669939 |
SMILES: | COC(=O)Cc1cccc(c1)[N+](=O)[O-] |
Complexity: | 223 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 3 |
XLogP3: | 1.8 |
Methyl 3-Nitrophenylacetate is a versatile compound commonly employed in chemical synthesis due to its unique properties and reactivity. This compound serves as a crucial building block in the preparation of various organic compounds and is frequently used in pharmaceutical and agrochemical industries.One of the key applications of Methyl 3-Nitrophenylacetate is its use as a precursor in the synthesis of pharmaceutical intermediates. By undergoing various chemical transformations, this compound can be converted into structurally diverse molecules that exhibit potential therapeutic effects. The versatility of Methyl 3-Nitrophenylacetate in organic synthesis allows for the creation of complex molecular structures that are essential for drug development.Additionally, Methyl 3-Nitrophenylacetate plays a significant role in the preparation of agrochemicals. Its ability to participate in various chemical reactions makes it a valuable starting material in the synthesis of pesticides, herbicides, and fungicides. Through strategic modifications, this compound can be transformed into active ingredients that effectively combat plant pests and diseases.In summary, Methyl 3-Nitrophenylacetate is a crucial component in the field of chemical synthesis, particularly in the production of pharmaceutical and agrochemical compounds. Its versatile nature and reactivity make it a valuable tool for chemists seeking to access a wide range of structurally diverse molecules with important applications in various industries.