AA10354
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $25.00 | $18.00 | - + | |
1g | 95% | in stock | $64.00 | $45.00 | - + | |
5g | 95% | in stock | $139.00 | $97.00 | - + | |
25g | 95% | in stock | $549.00 | $384.00 | - + | |
100g | 95% | in stock | $1,540.00 | $1,078.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA10354 |
Chemical Name: | 6-Bromo-2-fluoro-3-(trifluoromethyl)benzoic acid |
CAS Number: | 1026962-68-4 |
Molecular Formula: | C8H3BrF4O2 |
Molecular Weight: | 287.0058 |
MDL Number: | MFCD21365092 |
SMILES: | OC(=O)c1c(Br)ccc(c1F)C(F)(F)F |
Complexity: | 256 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
XLogP3: | 3.1 |
6-Bromo-2-fluoro-3-(trifluoromethyl)benzoic acid is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it a valuable building block in the development of various organic compounds. This compound is particularly valuable in the pharmaceutical industry, where it can be utilized in the synthesis of novel drug candidates. Additionally, it is commonly employed in the preparation of specialty chemicals and agrochemicals. Its trifluoromethyl group enhances the compound's stability and reactivity, making it a valuable tool for organic chemists in designing and creating complex molecules for a wide range of applications.