AA10372
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
5g | 98% | in stock | $25.00 | $17.00 | - + | |
25g | 98% | in stock | $55.00 | $39.00 | - + | |
100g | 98% | in stock | $185.00 | $130.00 | - + | |
500g | 98% | in stock | $758.00 | $531.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA10372 |
Chemical Name: | N-Acetyl-3,5-diiodo-L-tyrosine |
CAS Number: | 1027-28-7 |
Molecular Formula: | C11H11I2NO4 |
Molecular Weight: | 475.0183 |
MDL Number: | MFCD09842134 |
SMILES: | OC(=O)[C@H](Cc1cc(I)c(c(c1)I)O)NC(=O)C |
Complexity: | 314 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 3 |
Rotatable Bond Count: | 4 |
XLogP3: | 2.1 |
The compound (S)-2-Acetamido-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid, also known as $name$, is a valuable chiral building block in chemical synthesis. Its unique structure and chirality make it a versatile intermediate for the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. In particular, (S)-2-Acetamido-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid can be utilized in the synthesis of biologically active compounds and complex organic molecules that require specific stereochemical control. This compound serves as a key starting material for the creation of novel drug candidates, research chemicals, and other high-value products in the field of organic chemistry. Its presence in the synthesis pathway contributes to the overall efficiency and success of chemical reactions, leading to the development of new materials and compounds with enhanced properties and functionalities.