AA10578
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 98% | in stock | $38.00 | $27.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA10578 |
Chemical Name: | Potassium cyclopentoxymethyltrifluoroborate |
CAS Number: | 1027642-31-4 |
Molecular Formula: | C6H11BF3KO |
Molecular Weight: | 206.0554 |
MDL Number: | MFCD11505926 |
SMILES: | F[B-](COC1CCCC1)(F)F.[K+] |
Complexity: | 125 |
Covalently-Bonded Unit Count: | 2 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Rotatable Bond Count: | 2 |
Potassium ((cyclopentyloxy)methyl)trifluoroborate is a versatile reagent widely utilized in organic and medicinal chemistry for its unique reactivity and functional group compatibility. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals.In chemical synthesis, Potassium ((cyclopentyloxy)methyl)trifluoroborate can undergo Suzuki-Miyaura cross-coupling reactions with aryl or heteroaryl halides, enabling the efficient formation of carbon-carbon bonds. This reaction is valuable in the construction of complex organic molecules, such as biologically active compounds and natural product derivatives.Furthermore, the trifluoroborate moiety in this reagent can be selectively manipulated to introduce diverse functional groups into the target molecule, offering synthetic chemists a high degree of control over the regioselectivity and stereochemistry of the final product. This level of precision is crucial for designing molecules with specific biological activities or properties.Overall, the application of Potassium ((cyclopentyloxy)methyl)trifluoroborate in chemical synthesis showcases its importance as a valuable tool for the strategic design and efficient construction of novel compounds with potential applications in drug discovery and material science.