logo
Home  > 7-Fluoro-8-nitroquinazolin-4(3H)-one

AE27959

1027929-81-2 | 7-Fluoro-8-nitroquinazolin-4(3H)-one

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE27959
Chemical Name: 7-Fluoro-8-nitroquinazolin-4(3H)-one
CAS Number: 1027929-81-2
Molecular Formula: C8H4FN3O3
Molecular Weight: 209.1341
MDL Number: MFCD30566227
SMILES: [O-][N+](=O)c1c(F)ccc2c1nc[nH]c2=O

 

Upstream Synthesis Route 
  • 7-Fluoro-8-nitroquinazolin-4(3H)-one is a versatile compound commonly used in chemical synthesis, particularly in the pharmaceutical and agrochemical industries. This compound serves as a key building block in the creation of various biologically active molecules and compounds. Its unique structural features make it an essential intermediate in the creation of diverse organic compounds with potential biological activities. In chemical synthesis, this compound plays a crucial role in the development of new drugs, crop protection agents, and materials with specialized properties. Its presence enables chemists to access a wide range of molecular structures that contribute to advancing scientific research and innovation in the field of organic chemistry.
FEATURED PRODUCTS