logo
Home  > Quinoline, 2-methoxy-, 1-oxide

AD51157

10285-99-1 | Quinoline, 2-methoxy-, 1-oxide

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD51157
Chemical Name: Quinoline, 2-methoxy-, 1-oxide
CAS Number: 10285-99-1
Molecular Formula: C10H9NO2
Molecular Weight: 175.184
SMILES: COc1ccc2c([n+]1[O-])cccc2

 

Upstream Synthesis Route
  • Quinoline, 2-methoxy-, 1-oxide, also known as 2-Methoxyquinoline N-oxide, is a versatile compound widely utilized in chemical synthesis. This compound is primarily used as a powerful oxidizing agent in various organic reactions. Its unique properties make it an essential reagent in the development of novel synthetic methodologies.One of the key applications of Quinoline, 2-methoxy-, 1-oxide is in the oxidation of organic substrates. It serves as an efficient reagent for the conversion of alcohols to carbonyl compounds, particularly aldehydes and ketones. Furthermore, its ability to selectively oxidize sulfur compounds to sulfoxides and sulfones makes it a valuable tool in organic synthesis.Additionally, Quinoline, 2-methoxy-, 1-oxide plays a crucial role in the functionalization of aromatic compounds. It can be employed for the regioselective oxidation of aromatic ethers to yield valuable intermediates for the synthesis of pharmaceuticals, agrochemicals, and natural products. Its versatility in facilitating C-H bond activation reactions further enhances its utility in the construction of complex organic molecules.In summary, Quinoline, 2-methoxy-, 1-oxide is a versatile compound with diverse applications in chemical synthesis, ranging from oxidation reactions to functional group transformations. Its efficacy and selectivity make it a valuable reagent in the arsenal of synthetic chemists seeking to access novel compounds and develop innovative synthetic routes.
FEATURED PRODUCTS