AE08805
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08805 |
Chemical Name: | D-MYO-INOSITOL 1,3,4,5-TETRAKIS-PHOSPHATE AMMONIUM SALT |
CAS Number: | 102850-29-3 |
Molecular Formula: | C6H16O18P4 |
Molecular Weight: | 500.0755 |
MDL Number: | MFCD00213747 |
SMILES: | OC1C(OP(=O)(O)O)C(OP(=O)(O)O)C(C(C1OP(=O)(O)O)O)OP(=O)(O)O |
Inositol 1,3,4,5-tetraphosphate (IP4) is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. This compound functions as a multifunctional ligand in coordination chemistry, forming complexes with various metals that can be utilized in catalytic processes. In organic synthesis, IP4 can act as a chelating agent, facilitating complex reactions and improving yields. Additionally, IP4's ability to stabilize metal ions makes it a valuable tool in the preparation of novel materials and in the development of new chemical entities. Its applications in chemical synthesis extend to the fields of pharmaceuticals, materials science, and catalysis, making it an indispensable component in modern laboratory research.