logo
Home  > Copper(II) perchlorate hexahydrate

AB72249

10294-46-9 | Copper(II) perchlorate hexahydrate

Packsize Purity Availability Price Discounted Price    Quantity
25g 98% in stock $90.00 $63.00 -   +
100g 98% in stock $126.00 $88.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AB72249
Chemical Name: Copper(II) perchlorate hexahydrate
CAS Number: 10294-46-9
Molecular Formula: Cl2CuO8
Molecular Weight: 262.4472
MDL Number: MFCD00661054
SMILES: [O-][Cl](=O)(=O)=O.[O-][Cl](=O)(=O)=O.[Cu+2]

 

Upstream Synthesis Route
  • Copper(II) perchlorate hexahydrate is a versatile chemical compound that finds widespread application in chemical synthesis processes. As a powerful oxidizing agent, it plays a crucial role in various organic reactions and in the production of specialty chemicals. Its ability to undergo redox reactions makes it particularly useful in the synthesis of complex molecules and coordination compounds. Additionally, Copper(II) perchlorate hexahydrate can serve as a catalyst in certain reactions, enhancing reaction rates and yields. Its unique properties make it a valuable tool for chemists and researchers seeking to develop and optimize synthetic pathways in both academic and industrial settings.
FEATURED PRODUCTS