logo
Home  > 5-Hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile

AB51994

1029439-74-4 | 5-Hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile

Packsize Purity Availability Price Discounted Price    Quantity
50mg 96% in stock $75.00 $52.00 -   +
100mg 96% in stock $126.00 $89.00 -   +
250mg 96% in stock $210.00 $147.00 -   +
1g 96% in stock $630.00 $441.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB51994
Chemical Name: 5-Hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile
CAS Number: 1029439-74-4
Molecular Formula: C13H16BNO3
Molecular Weight: 245.082
MDL Number: MFCD16994357
SMILES: N#Cc1cc(O)ccc1B1OC(C(O1)(C)C)(C)C

 

Upstream Synthesis Route 
  • 5-Hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile is a versatile compound utilized in chemical synthesis for its unique properties. This compound serves as a key building block in organic chemistry reactions, particularly in the field of medicinal chemistry and pharmaceutical development. Its presence in a reaction mixture can enable the selective formation of carbon-carbon or carbon-heteroatom bonds, making it a valuable tool for constructing complex molecular structures with high efficiency. Moreover, its specific structure containing both a hydroxy group and a dioxaborolane moiety offers opportunities for further derivatization, enabling the synthesis of a diverse range of functionalized molecules with potential biological activity.
FEATURED PRODUCTS