AD50414
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $330.00 | $231.00 | - + | |
1g | 98% | in stock | $634.00 | $444.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD50414 |
Chemical Name: | 4-Hydroxy-2-(trifluoromethyl)phenylboronic acid, pinacol ester |
CAS Number: | 1029439-76-6 |
Molecular Formula: | C13H16BF3O3 |
Molecular Weight: | 288.0705 |
MDL Number: | MFCD15143616 |
SMILES: | Oc1ccc(c(c1)C(F)(F)F)B1OC(C(O1)(C)C)(C)C |
Complexity: | 354 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 20 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 1 |
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)phenol is a powerful reagent commonly utilized in organic chemical synthesis. This compound plays a crucial role in various reactions due to its unique properties. In chemical synthesis, it acts as a versatile building block for creating complex organic molecules through coupling reactions. The boron atom in the dioxaborolane moiety enables selective cross-coupling reactions with aryl halides or pseudohalides, leading to the formation of biaryl compounds. Additionally, the trifluoromethyl group enhances the reactivity and stability of the molecule, making it a valuable tool in modern synthetic organic chemistry. Its application extends to the synthesis of pharmaceuticals, agrochemicals, and materials with tailored properties, showcasing its importance in the realm of chemical research and development.