logo
Home  > 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]echinocandin B hydrochloride (1

AE28000

1029890-89-8 | 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]echinocandin B hydrochloride (1

Packsize Purity Availability Price Discounted Price    Quantity
5mg 98% 2 weeks $48.00 $34.00 -   +
10mg 98% 2 weeks $56.00 $39.00 -   +
25mg 98% 2 weeks $122.00 $85.00 -   +
50mg 98% 2 weeks $135.00 $95.00 -   +
250mg 98% 2 weeks $254.00 $178.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE28000
Chemical Name: 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]echinocandin B hydrochloride (1
CAS Number: 1029890-89-8
Molecular Formula: C34H52ClN7O15
Molecular Weight: 834.2675800000002
SMILES: Oc1ccc(cc1)[C@@H]([C@H]([C@@H]1NC(=O)[C@@H]2C[C@H](CN2C(=O)[C@@H](NC(=O)[C@@H](N)C[C@H]([C@H](NC(=O)[C@H]2N(C(=O)[C@@H](NC1=O)[C@H](O)C)C[C@@H]([C@@H]2O)C)O)O)[C@H](O)C)O)O)O.Cl

 

Upstream Synthesis Route 
  • 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]echinocandin B hydrochloride is a valuable chemical reagent in organic synthesis due to its unique structural properties. This compound serves as a key intermediate in the preparation of various complex molecules with potential applications in pharmaceuticals, agrochemicals, and materials science. In chemical synthesis, 1-[(4R,5R)-4,5-Dihydroxy-L-ornithine]echinocandin B hydrochloride can be utilized as a chiral building block to introduce stereochemistry and functional groups into target molecules. Its presence in a synthetic pathway enables the creation of diverse molecular architectures with high efficiency and selectivity, making it a versatile tool for the construction of biologically active compounds and advanced materials. By incorporating this compound into synthesis strategies, researchers can access novel chemical entities and optimize synthetic routes to develop innovative products with enhanced properties and biological activities.
FEATURED PRODUCTS