logo
Home  > 3,5-Bis(perfluorohexyl)pyrazole

AE12815

1030269-33-0 | 3,5-Bis(perfluorohexyl)pyrazole

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE12815
Chemical Name: 3,5-Bis(perfluorohexyl)pyrazole
CAS Number: 1030269-33-0
Molecular Formula: C15H2F26N2
Molecular Weight: 704.1483
MDL Number: MFCD06246011
SMILES: FC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(c1n[nH]c(c1)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F

 

Upstream Synthesis Route 
  • The compound 3,5-Bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrazole is commonly utilized in chemical synthesis as a versatile reagent for introducing specific functional groups into organic compounds. Its unique structure, containing multiple fluorine atoms, allows for precise manipulation of molecular properties during various synthetic processes. By incorporating this compound into reactions, chemists can modify the reactivity, polarity, and overall characteristics of target molecules. This enables the synthesis of specialized materials, pharmaceuticals, and agrochemicals with tailored properties for specific applications. Additionally, the 3,5-Bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrazole compound has shown promising results in the development of advanced materials and fine chemicals, highlighting its significance in modern chemical research and development.
FEATURED PRODUCTS