logo
Home  > Inhibitors/Agonists  > Immunology/Inflammation  > COX  > Tribenoside

AD80942

10310-32-4 | Tribenoside

Packsize Purity Availability Price Discounted Price    Quantity
100mg 95% in stock $29.00 $20.00 -   +
1g 95% in stock $46.00 $32.00 -   +
5g 95% in stock $199.00 $140.00 -   +
10g 95% in stock $281.00 $197.00 -   +
25g 95% in stock $572.00 $400.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD80942
Chemical Name: Tribenoside
CAS Number: 10310-32-4
Molecular Formula: C29H34O6
Molecular Weight: 478.5767
MDL Number: MFCD00801089
SMILES: CCOC1O[C@@H]([C@@H]([C@H]1O)OCc1ccccc1)[C@H](OCc1ccccc1)COCc1ccccc1

 

Computed Properties
Complexity: 555  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 4  
Heavy Atom Count: 35  
Hydrogen Bond Acceptor Count: 6  
Hydrogen Bond Donor Count: 1  
Rotatable Bond Count: 13  
Undefined Atom Stereocenter Count: 1  
XLogP3: 3.9  

 

 

Upstream Synthesis Route
  • Tribenoside, also known as 2-(3,4,5-trihydroxybenzoyl)oxybenzoic acid, is a versatile compound widely used in chemical synthesis. It serves as a crucial building block in various organic reactions, particularly in the synthesis of complex pharmaceuticals and natural products.Tribenoside's unique chemical structure makes it a valuable reagent for the formation of ester bonds, as well as in the modification of aromatic systems. This compound is frequently employed as a protecting group for hydroxyl functionalities due to its stability under a wide range of reaction conditions.In addition, Tribenoside's ability to undergo selective functionalization at different positions within its molecular framework makes it a valuable tool in designing and constructing intricate chemical architectures. Its presence in the synthesis of biologically active compounds highlights its significance in medicinal chemistry and drug discovery applications.Overall, Tribenoside plays a crucial role in the advancement of chemical synthesis strategies, enabling chemists to access novel compounds with diverse pharmacological properties.
Literature
FEATURED PRODUCTS