AD80942
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $29.00 | $20.00 | - + | |
1g | 95% | in stock | $46.00 | $32.00 | - + | |
5g | 95% | in stock | $199.00 | $140.00 | - + | |
10g | 95% | in stock | $281.00 | $197.00 | - + | |
25g | 95% | in stock | $572.00 | $400.00 | - + | |
100g | 95% | in stock | $2,002.00 | $1,402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD80942 |
Chemical Name: | Tribenoside |
CAS Number: | 10310-32-4 |
Molecular Formula: | C29H34O6 |
Molecular Weight: | 478.5767 |
MDL Number: | MFCD00801089 |
SMILES: | CCOC1O[C@@H]([C@@H]([C@H]1O)OCc1ccccc1)[C@H](OCc1ccccc1)COCc1ccccc1 |
Complexity: | 555 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 35 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 13 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 3.9 |
Tribenoside, also known as 2-(3,4,5-trihydroxybenzoyl)oxybenzoic acid, is a versatile compound widely used in chemical synthesis. It serves as a crucial building block in various organic reactions, particularly in the synthesis of complex pharmaceuticals and natural products.Tribenoside's unique chemical structure makes it a valuable reagent for the formation of ester bonds, as well as in the modification of aromatic systems. This compound is frequently employed as a protecting group for hydroxyl functionalities due to its stability under a wide range of reaction conditions.In addition, Tribenoside's ability to undergo selective functionalization at different positions within its molecular framework makes it a valuable tool in designing and constructing intricate chemical architectures. Its presence in the synthesis of biologically active compounds highlights its significance in medicinal chemistry and drug discovery applications.Overall, Tribenoside plays a crucial role in the advancement of chemical synthesis strategies, enabling chemists to access novel compounds with diverse pharmacological properties.
Reproductive toxicology (Elmsford, N.Y.) 20110501
Biological & pharmaceutical bulletin 20100101
Contact dermatitis 20090601
Vestnik khirurgii imeni I. I. Grekova 20080101
Acta dermato-venereologica 20050101