AE28113
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $339.00 | $237.00 | - + | |
250mg | 95% | in stock | $603.00 | $422.00 | - + | |
1g | 95% | in stock | $1,504.00 | $1,053.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE28113 |
Chemical Name: | tert-Butyl 2'-oxo-2',3'-dihydro-1'H-spiro[piperidine-4,4'-quinoline]-1-carboxylate |
CAS Number: | 1032143-13-7 |
Molecular Formula: | C18H24N2O3 |
Molecular Weight: | 316.3948 |
MDL Number: | MFCD15530225 |
SMILES: | O=C1Nc2ccccc2C2(C1)CCN(CC2)C(=O)OC(C)(C)C |
Complexity: | 475 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.2 |
The tert-Butyl 2'-oxo-2',3'-dihydro-1'H-spiro[piperidine-4,4'-quinoline]-1-carboxylate plays a crucial role in chemical synthesis due to its unique structure and reactivity. This compound is widely utilized as a versatile building block in the creation of complex organic molecules and pharmaceuticals. With its spirocyclic nature and functional groups, it enables the construction of diverse molecular scaffolds that are challenging to access using traditional synthetic methods. In addition, the presence of the tert-butyl ester group provides stability during various chemical transformations, allowing for selective modifications at specific positions. Researchers and chemists rely on tert-Butyl 2'-oxo-2',3'-dihydro-1'H-spiro[piperidine-4,4'-quinoline]-1-carboxylate as a valuable tool in the synthesis of novel compounds with potential applications in drug discovery, material science, and other areas of chemical research.