AD70356
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $81.00 | $57.00 | - + | |
250mg | 95% | in stock | $137.00 | $96.00 | - + | |
500mg | 95% | in stock | $240.00 | $168.00 | - + | |
1g | 95% | in stock | $355.00 | $248.00 | - + | |
5g | 95% | in stock | $1,092.00 | $765.00 | - + | |
10g | 95% | in stock | $1,893.00 | $1,325.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD70356 |
Chemical Name: | tert-Butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate |
CAS Number: | 1032158-48-7 |
Molecular Formula: | C12H20N2O3 |
Molecular Weight: | 240.2988 |
MDL Number: | MFCD12198504 |
SMILES: | O=C(N1CCC2(CC1)CNC2=O)OC(C)(C)C |
Complexity: | 338 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 0.5 |
The tert-Butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate is a versatile compound commonly used in chemical synthesis. Its unique spirocyclic structure and functional groups make it a valuable building block in the creation of various organic molecules.In chemical synthesis, this compound plays a crucial role as a precursor in the formation of complex heterocyclic compounds. Its presence allows for the introduction of diverse functionalities through selective reactions, enabling the synthesis of diverse analogs and derivatives with potentially unique properties.Additionally, tert-Butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate is often utilized as a protecting group for sensitive functional groups or reactive sites within a molecule. This protection strategy helps to prevent unwanted side reactions or undesired interactions during the synthesis process, ensuring the successful formation of the target compound.Overall, the application of tert-Butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate in chemical synthesis offers chemists a strategic tool for the construction of complex organic molecules with tailored properties and functionalities.