AD70349
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10g | 97% | in stock | $6.00 | $4.00 | - + | |
25g | 97% | in stock | $12.00 | $9.00 | - + | |
100g | 97% | in stock | $33.00 | $23.00 | - + | |
500g | 97% | in stock | $82.00 | $57.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD70349 |
Chemical Name: | D-(-)-Arabinose |
CAS Number: | 10323-20-3 |
Molecular Formula: | C5H10O5 |
Molecular Weight: | 150.1299 |
MDL Number: | MFCD00135608 |
SMILES: | OC[C@H]([C@H]([C@@H](C=O)O)O)O |
Complexity: | 104 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 3 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 4 |
XLogP3: | -2.3 |
The Journal of organic chemistry 20020614