BI37466
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 2 weeks | $1,328.00 | $930.00 | - + | ||
250mg | 2 weeks | $2,829.00 | $1,980.00 | - + | ||
1g | 2 weeks | $8,042.00 | $5,629.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | BI37466 |
Chemical Name: | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-β,β,4,6-tetramethyl-2-[(2-nitrophenyl)methoxy]phenylalanine |
CAS Number: | 1032400-98-8 |
Molecular Formula: | C35H34N2O7 |
Molecular Weight: | 594.6537 |
SMILES: | O=C(NC(C(c1c(C)cc(cc1OCc1ccccc1N(=O)=O)C)(C)C)C(=O)O)OCC1c2ccccc2-c2c1cccc2 |
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-β,β,4,6-tetramethyl-2-[(2-nitrophenyl)methoxy]phenylalanine is a valuable compound in chemical synthesis due to its versatility and unique structural features. Its application extends to various aspects of synthetic chemistry, particularly in peptide synthesis and drug development. This compound serves as a crucial building block in the construction of peptide molecules with specific functionalities and structures.Specifically, this compound can be utilized as a protecting group for amino acids during peptide synthesis. The fluorenylmethoxycarbonyl (Fmoc) protecting group, derived from the fluorenyl moiety in the compound, is commonly employed in solid-phase peptide synthesis due to its stability and ease of removal under mild conditions. By utilizing N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-β,β,4,6-tetramethyl-2-[(2-nitrophenyl)methoxy]phenylalanine as a protecting group, chemists can selectively add amino acids in a controlled manner to assemble complex peptide sequences.Furthermore, the nitrophenyl functionality present in the compound offers the opportunity for additional functionalization and diversification in chemical synthesis. This group can be further modified to introduce desired properties or reactivity into the molecule, expanding the potential applications of the synthesized peptides or compounds.Overall, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-β,β,4,6-tetramethyl-2-[(2-nitrophenyl)methoxy]phenylalanine plays a crucial role in the efficient and precise synthesis of peptides and related compounds, making it an essential tool for chemical researchers and drug developers.