AE10086
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $8.00 | $5.00 | - + | |
1g | 95% | in stock | $13.00 | $9.00 | - + | |
5g | 95% | in stock | $50.00 | $35.00 | - + | |
10g | 95% | in stock | $98.00 | $68.00 | - + | |
25g | 95% | in stock | $243.00 | $170.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10086 |
Chemical Name: | 5'-O-(4,4'-Dimethoxytrityl)-2'-o-methyluridine |
CAS Number: | 103285-22-9 |
Molecular Formula: | C31H32N2O8 |
Molecular Weight: | 560.5943800000001 |
MDL Number: | MFCD00274123 |
SMILES: | COc1ccc(cc1)C(c1ccc(cc1)OC)(c1ccccc1)OC[C@H]1O[C@H]([C@@H]([C@@H]1O)OC)n1ccc(=O)[nH]c1=O |
The compound 1-((2R,3R,4R,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxy-3-methoxytetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione finds significant utility in chemical synthesis as a versatile building block. It can serve as a key intermediate in the creation of complex molecules due to its unique structural features and functional groups. This compound can participate in various reactions, such as oxidation, reduction, nucleophilic substitution, and cycloaddition, enabling the formation of diverse chemical structures. Its presence in a synthesis pathway can lead to the generation of novel compounds with potential applications in pharmaceuticals, materials science, and agrochemicals.