AI05945
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $42.00 | $30.00 | - + | |
250mg | 95% | in stock | $57.00 | $40.00 | - + | |
1g | 95% | in stock | $134.00 | $94.00 | - + | |
5g | 95% | in stock | $391.00 | $274.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI05945 |
Chemical Name: | H-Leu-leu-leu-oh |
CAS Number: | 10329-75-6 |
Molecular Formula: | C18H35N3O4 |
Molecular Weight: | 357.4882 |
MDL Number: | MFCD00038309 |
SMILES: | CC(C[C@@H](C(=O)N[C@H](C(=O)O)CC(C)C)NC(=O)[C@H](CC(C)C)N)C |
The (S)-2-((S)-2-((S)-2-Amino-4-methylpentanamido)-4-methylpentanamido)-4-methylpentanoic acid, often referred to simply as $name$, is a highly versatile compound that plays a crucial role in chemical synthesis. This compound is particularly valued for its ability to serve as a key building block in peptide synthesis due to its intricate molecular structure.In chemical synthesis, (S)-2-((S)-2-((S)-2-Amino-4-methylpentanamido)-4-methylpentanamido)-4-methylpentanoic acid acts as a peptide linker, facilitating the formation of peptide bonds between amino acids. Its unique structure allows for precise control over the synthesis of complex peptides, making it an indispensable tool for researchers and chemists working in the field of biochemistry and pharmaceutical development.The proficiency of (S)-2-((S)-2-((S)-2-Amino-4-methylpentanamido)-4-methylpentanamido)-4-methylpentanoic acid in peptide synthesis enables the creation of custom peptides with specific sequences and properties, opening up possibilities for the design and production of novel bioactive compounds for various applications in medicine, biotechnology, and materials science.