AE10249
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 98% | in stock | $97.00 | $68.00 | - + | |
25mg | 98% | in stock | $170.00 | $119.00 | - + | |
50mg | 98% | in stock | $254.00 | $178.00 | - + | |
100mg | 98% | in stock | $400.00 | $280.00 | - + | |
250mg | 98% | in stock | $791.00 | $554.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE10249 |
Chemical Name: | GDP-ALPHA-D-MANNOSE, DISODIUM SALT |
CAS Number: | 103301-73-1 |
Molecular Formula: | C16H25N5Na2O16P2 |
Molecular Weight: | 651.3206620000001 |
MDL Number: | MFCD00799981 |
SMILES: | OC[C@H]1OC(OP(=O)(OP(=O)(OC[C@H]2O[C@H]([C@@H]([C@@H]2O)O)n2cnc3c2[nH]c(N)nc3=O)O)O)[C@H]([C@H]([C@@H]1O)O)O.[Na].[Na] |
Guanosine 5′-(trihydrogen diphosphate), P′-D-mannopyranosyl ester, disodium salt holds a vital role in chemical synthesis as it serves as a key component in the assembly of oligosaccharides. This particular compound acts as a powerful donor molecule, facilitating glycosylation reactions in the creation of complex carbohydrate structures. By utilizing this compound in a controlled chemical environment, chemists are able to intricately manipulate the formation of glycosidic bonds, enabling the synthesis of diverse bioactive compounds, pharmaceuticals, and potential therapeutic agents. The precise and selective nature of Guanosine 5′-(trihydrogen diphosphate), P′-D-mannopyranosyl ester, disodium salt makes it an invaluable tool for chemists seeking to engineer complex molecules with specific biological activities.